CAS 2159-40-2 appears in our catalog under these names: 2-(4-Bromobenzoyl)benzoic acid, 2-(4-Bromobenzoyl)benzoic acid, 98%, 2-(4-Bromobenzoyl)benzoic acid, 96%, 2-(4-Bromobenzoyl)Benzoic Acid, 96%, 96%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 10g, 100mg.
2-(4-bromobenzoyl)benzoic acid (CAS 2159-40-2) is a chemical compound with the molecular formula C14H9BrO3 and a molecular weight of 305.12 g/mol. IUPAC name: 2-(4-bromobenzoyl)benzoic acid. InChIKey: NONNFIAFWRSPPY-UHFFFAOYSA-N.
| Molecular formula | C14H9BrO3 |
|---|---|
| Molecular weight | 305.12 g/mol |
| IUPAC name | 2-(4-bromobenzoyl)benzoic acid |
| InChIKey | NONNFIAFWRSPPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)