cas: 936494-74-5 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-2-(hydroxymethyl)propane-1,3-diol, 95%, 95% (CAS 936494-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHPY-100mg |
| cas | 936494-74-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 702.80 Pln | |
| Chemat | 1g | 1806.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-2-(hydroxymethyl)propane-1,3-diol (CAS 936494-74-5) is a chemical compound with the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. IUPAC name: 2-(4-bromophenyl)-2-(hydroxymethyl)propane-1,3-diol. InChIKey: PTFBRTJXVDPNFS-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO3 |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-(hydroxymethyl)propane-1,3-diol |
| InChIKey | PTFBRTJXVDPNFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CO)(CO)CO)Br |
Computed by PubChem (NCBI)