2-(4-Bromophenyl)sulfonylethanol, 95%
cas: 107737-89-3 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)sulfonylethanol, 95% (CAS 107737-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A991218-100mg |
| cas | 107737-89-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 1877.81 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 976.40 Pln | |
| Chemat | 1g | 2339.60 Pln | |
| BLDpharm | 100mg | 741.99 Pln | |
| BLDpharm | 250mg | 1036.33 Pln | |
| BLDpharm | 1g | 2019.31 Pln | |
| Fluorochem | 100mg | 1237.08 Pln | |
| Fluorochem | 250mg | 1804.59 Pln | |
| Fluorochem | 1g | 4329.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-bromophenyl)sulfonylethanol (CAS 107737-89-3) is a chemical compound with the molecular formula C8H9BrO3S and a molecular weight of 265.13 g/mol. IUPAC name: 2-(4-bromophenyl)sulfonylethanol. InChIKey: JEYIKZQANLPVBY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO3S |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)sulfonylethanol |
| InChIKey | JEYIKZQANLPVBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCO)Br |
Computed by PubChem (NCBI)