cas: 40133-22-0 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)thiophene 97% (CAS 40133-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361365-250mg |
| cas | 40133-22-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 2089.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A361365 |
2-(4-bromophenyl)thiophene (CAS 40133-22-0) is a chemical compound with the molecular formula C10H7BrS and a molecular weight of 239.13 g/mol. IUPAC name: 2-(4-bromophenyl)thiophene. InChIKey: XKOJJKOSNQXQGP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrS |
|---|---|
| Molecular weight | 239.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)thiophene |
| InChIKey | XKOJJKOSNQXQGP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)