cas: 942070-06-6 — see every product listed under this CAS number, including other names
2-(4-Bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 942070-06-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270131-250mg |
| cas | 942070-06-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 2712.19 Pln | |
| Ambeed | 10g | 5159.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270131 |
2-(4-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 942070-06-6) is a chemical compound with the molecular formula C10H14BBrO2S and a molecular weight of 289.00 g/mol. IUPAC name: 2-(4-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XOLVNUOSAPZSLF-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO2S |
|---|---|
| Molecular weight | 289.00 g/mol |
| IUPAC name | 2-(4-bromothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XOLVNUOSAPZSLF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)Br |
Computed by PubChem (NCBI)