cas: 175137-19-6 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (CAS 175137-19-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008258-250MG |
| cas | 175137-19-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 346.77 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl chloride (CAS 175137-19-6) is a chemical compound with the molecular formula C11H5Cl2F3N2O and a molecular weight of 309.07 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl chloride. InChIKey: NEJFCXJQJOAJMO-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl2F3N2O |
|---|---|
| Molecular weight | 309.07 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| InChIKey | NEJFCXJQJOAJMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)