2-(4-Chlorophenyl)-4'-iodoacetophenone, 95%
cas: 898784-08-2 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-4'-iodoacetophenone, 95% (CAS 898784-08-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A372758-250mg |
| cas | 898784-08-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 419.88 Pln | |
| BLDpharm | 1g | 991.90 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1731.70 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-chlorophenyl)-1-(4-iodophenyl)ethanone (CAS 898784-08-2) is a chemical compound with the molecular formula C14H10ClIO and a molecular weight of 356.58 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-(4-iodophenyl)ethanone. InChIKey: VHSYBPGJDUDBQR-UHFFFAOYSA-N.
| Molecular formula | C14H10ClIO |
|---|---|
| Molecular weight | 356.58 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-(4-iodophenyl)ethanone |
| InChIKey | VHSYBPGJDUDBQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C2=CC=C(C=C2)I)Cl |
Computed by PubChem (NCBI)