cas: 820223-94-7 — see every product listed under this CAS number, including other names
2-(4-Cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 820223-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219850-250MG |
| cas | 820223-94-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1388.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 820223-94-7) is a chemical compound with the molecular formula C18H27BO2 and a molecular weight of 286.2 g/mol. IUPAC name: 2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TYHPJCMZSCFGIX-UHFFFAOYSA-N.
| Molecular formula | C18H27BO2 |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 2-(4-cyclohexylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TYHPJCMZSCFGIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCCCC3 |
Computed by PubChem (NCBI)