cas: 154355-88-1 — see every product listed under this CAS number, including other names
2-(4-Fluorobenzyl)-5-iodothiophene, 97% (CAS 154355-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A130546-1g |
| cas | 154355-88-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4080.16 Pln | |
| AmBeed | 10g | 24111.43 Pln | |
| AmBeed | 5g | 13422.01 Pln | |
| Fluorochem | 100mg | 1008.00 Pln | |
| Fluorochem | 250mg | 1315.18 Pln | |
| Fluorochem | 500mg | 2543.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(4-fluorophenyl)methyl]-5-iodothiophene (CAS 154355-88-1) is a chemical compound with the molecular formula C11H8FIS and a molecular weight of 318.15 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]-5-iodothiophene. InChIKey: PNRNSMBTRRXYBQ-UHFFFAOYSA-N.
| Molecular formula | C11H8FIS |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl]-5-iodothiophene |
| InChIKey | PNRNSMBTRRXYBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(S2)I)F |
Computed by PubChem (NCBI)