2-(4-Fluorophenyl)thiophene, 95%
cas: 58861-48-6 — see every product listed under this CAS number, including other names
2-(4-Fluorophenyl)thiophene, 95% (CAS 58861-48-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A137830-5g |
| cas | 58861-48-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1627.50 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 198.80 Pln | |
| Chemat | 500g | 816.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 169.96 Pln | |
| BLDpharm | 100g | 408.77 Pln | |
| BLDpharm | 500g | 1747.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-fluorophenyl)thiophene (CAS 58861-48-6) is a chemical compound with the molecular formula C10H7FS and a molecular weight of 178.23 g/mol. IUPAC name: 2-(4-fluorophenyl)thiophene. InChIKey: PURJRGMZIKXDMW-UHFFFAOYSA-N.
| Molecular formula | C10H7FS |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)thiophene |
| InChIKey | PURJRGMZIKXDMW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)