cas: 5572-94-1 — see every product listed under this CAS number, including other names
2-(4-Iodophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95%, 95% (CAS 5572-94-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0XT-250mg |
| cas | 5572-94-1 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 347.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-iodophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 5572-94-1) is a chemical compound with the molecular formula C11H14BIO2 and a molecular weight of 315.95 g/mol. IUPAC name: 2-(4-iodophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: JKKCLZFCRZKJEG-UHFFFAOYSA-N.
| Molecular formula | C11H14BIO2 |
|---|---|
| Molecular weight | 315.95 g/mol |
| IUPAC name | 2-(4-iodophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | JKKCLZFCRZKJEG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)