cas: 1073353-81-7 — see every product listed under this CAS number, including other names
2-(4-Methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 1073353-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A827611-100mg |
| cas | 1073353-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2028.00 Pln | |
| Ambeed | 10g | 3424.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A827611 |
2-(4-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-81-7) is a chemical compound with the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. IUPAC name: 2-(4-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KVPUEHWNHSWGSJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO5 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | 2-(4-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KVPUEHWNHSWGSJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)