2-(4-Methoxyphenyl)propanoic acid, 95%
cas: 942-54-1 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)propanoic acid, 95% (CAS 942-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-5773-250mg |
| cas | 942-54-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 804.94 Pln | |
| Fluorochem | 5g | 2934.40 Pln | |
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Ambeed | 5g | 2845.69 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 786.41 Pln | |
| BLDpharm | 5g | 3363.28 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 2099.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(4-methoxyphenyl)propanoic acid (CAS 942-54-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(4-methoxyphenyl)propanoic acid. InChIKey: KBDLTYNZHQRMQC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)propanoic acid |
| InChIKey | KBDLTYNZHQRMQC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
p-methoxyphenylpropionic acid, 2-(4-Methoxyphenyl)propanoic acid, Benzeneacetic acid, 4-methoxy-a-methyl-, 2-(4-methoxyphenyl)-propionic acid, Propanoic acid, 2-(4-methoxyphenyl), 2-(4-Methoxyphenyl)propanoicacid, 2-(p-Methoxyphenyl)propionic acid, 2-(4-Methoxyphenyl)propionic Acid, Benzeneacetic acid, 4-methoxy-alpha-methyl-, p-Methoxyphenylpropionsaure