cas: 942922-07-8 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 98% (CAS 942922-07-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217386-250MG |
| cas | 942922-07-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1257.91 Pln | |
| Fluorochem | 25g | 5881.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 942922-07-8) is a chemical compound with the molecular formula C15H25BN4O2 and a molecular weight of 304.20 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: LGIDGOSYDQTQDO-UHFFFAOYSA-N.
| Molecular formula | C15H25BN4O2 |
|---|---|
| Molecular weight | 304.20 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | LGIDGOSYDQTQDO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCN(CC3)C |
Computed by PubChem (NCBI)