cas: 1710203-01-2 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)pyrimidine-5-carbonitrile, ≥95%, ≥95% (CAS 1710203-01-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLMX-250mg |
| cas | 1710203-01-2 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 2680.40 Pln | |
| Chemat | 10g | 4437.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylpiperazin-1-yl)pyrimidine-5-carbonitrile (CAS 1710203-01-2) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)pyrimidine-5-carbonitrile. InChIKey: UXSDFEAXDJXAJA-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)pyrimidine-5-carbonitrile |
| InChIKey | UXSDFEAXDJXAJA-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC=C(C=N2)C#N |
Computed by PubChem (NCBI)