cas: 197251-71-1 — see every product listed under this CAS number, including other names
2-(4-Methylsulfonyl-2-nitrophenyl)malondialdehyde (CAS 197251-71-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023392-1G |
| cas | 197251-71-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 2064.92 Pln | |
| Fluorochem | 10g | 3173.90 Pln | |
| Fluorochem | 25g | 5048.24 Pln |
| delivery time | 2-3 weeks |
|---|
2-(4-methylsulfonyl-2-nitrophenyl)propanedial (CAS 197251-71-1) is a chemical compound with the molecular formula C10H9NO6S and a molecular weight of 271.25 g/mol. IUPAC name: 2-(4-methylsulfonyl-2-nitrophenyl)propanedial. InChIKey: DEDOAYHMNVGYGD-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6S |
|---|---|
| Molecular weight | 271.25 g/mol |
| IUPAC name | 2-(4-methylsulfonyl-2-nitrophenyl)propanedial |
| InChIKey | DEDOAYHMNVGYGD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(C=O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)