cas: 298690-84-3 — see every product listed under this CAS number, including other names
2-(4-Trifluoromethyl-phenyl)-pyrrolidine, 97% (CAS 298690-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032042-250MG |
| cas | 298690-84-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1247.50 Pln | |
| Fluorochem | 500mg | 1976.41 Pln | |
| Fluorochem | 1g | 3012.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(trifluoromethyl)phenyl]pyrrolidine (CAS 298690-84-3) is a chemical compound with the molecular formula C11H12F3N and a molecular weight of 215.21 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]pyrrolidine. InChIKey: GSOGADJIIMVREB-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]pyrrolidine |
| InChIKey | GSOGADJIIMVREB-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)