cas: 2364334-02-9 — see every product listed under this CAS number, including other names
2-(5-(Benzyloxy)pentyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2364334-02-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1379569-250mg |
| cas | 2364334-02-9 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 577.78 Pln | |
| AmBeed | 25g | 10225.60 Pln | |
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 5g | 3116.68 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,4,5,5-tetramethyl-2-(5-phenylmethoxypentyl)-1,3,2-dioxaborolane (CAS 2364334-02-9) is a chemical compound with the molecular formula C18H29BO3 and a molecular weight of 304.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-phenylmethoxypentyl)-1,3,2-dioxaborolane. InChIKey: DEGHOCUWGDSAIT-UHFFFAOYSA-N.
| Molecular formula | C18H29BO3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-phenylmethoxypentyl)-1,3,2-dioxaborolane |
| InChIKey | DEGHOCUWGDSAIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)