cas: 1360950-40-8 — see every product listed under this CAS number, including other names
2-(5-Borono-2-pyrimidinyl)imidodicarbonic acid 1,3-bis(tert-butyl) ester, 97% (CAS 1360950-40-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987466-1G |
| cas | 1360950-40-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 591.48 Pln | |
| Fluorochem | 5g | 2330.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid (CAS 1360950-40-8) is a chemical compound with the molecular formula C14H22BN3O6 and a molecular weight of 339.15 g/mol. IUPAC name: [2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid. InChIKey: YFKDVHNYIKJGIX-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O6 |
|---|---|
| Molecular weight | 339.15 g/mol |
| IUPAC name | [2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]boronic acid |
| InChIKey | YFKDVHNYIKJGIX-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)