2-(5-Ethoxy-2-fluoro-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 2828446-36-0 — see every product listed under this CAS number, including other names
2-(5-Ethoxy-2-fluoro-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2828446-36-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1627830-250mg |
| cas | 2828446-36-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1627.50 Pln | |
| Ambeed | 25g | 5521.25 Pln | |
| Chemat | 5g | 1562.00 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 503.18 Pln | |
| BLDpharm | 5g | 1591.69 Pln | |
| BLDpharm | 25g | 5412.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2828446-36-0) is a chemical compound with the molecular formula C15H19BF4O3 and a molecular weight of 334.12 g/mol. IUPAC name: 2-[5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JEXHZAKHDJYLPM-UHFFFAOYSA-N.
| Molecular formula | C15H19BF4O3 |
|---|---|
| Molecular weight | 334.12 g/mol |
| IUPAC name | 2-[5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JEXHZAKHDJYLPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C(F)(F)F)OCC |
Computed by PubChem (NCBI)