2-(6-([1,1'-Biphenyl]-3-yl)dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%
cas: 1858289-64-1 — see every product listed under this CAS number, including other names
2-(6-([1,1'-Biphenyl]-3-yl)dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1858289-64-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1144174-100mg |
| cas | 1858289-64-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1310.44 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 453.20 Pln | |
| BLDpharm | 5g | 1402.86 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 458.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane (CAS 1858289-64-1) is a chemical compound with the molecular formula C30H27BO2S and a molecular weight of 462.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane. InChIKey: YIQGVICVAGYGBO-UHFFFAOYSA-N.
| Molecular formula | C30H27BO2S |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane |
| InChIKey | YIQGVICVAGYGBO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C4=C(S3)C(=CC=C4)C5=CC=CC(=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)