Products 1308669-74-0
CAS 1308669-74-0 appears in our catalog under these names: 2-(6-Fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(6-Fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(6-fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1308669-74-0) is a chemical compound with the molecular formula C16H18BFO2 and a molecular weight of 272.1 g/mol. IUPAC name: 2-(6-fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KXJCEEXZOONZGI-UHFFFAOYSA-N.
| Molecular formula | C16H18BFO2 |
|---|---|
| Molecular weight | 272.1 g/mol |
| IUPAC name | 2-(6-fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KXJCEEXZOONZGI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)F |
Computed by PubChem (NCBI)