2-(Benzyloxy)-1-bromo-3-chlorobenzene, 97%
cas: 2244107-77-3 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-3-chlorobenzene, 97% (CAS 2244107-77-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1599300-250mg |
| cas | 2244107-77-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 4303.06 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 503.18 Pln | |
| BLDpharm | 1g | 1197.38 Pln | |
| BLDpharm | 5g | 4635.06 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1317.20 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 2450.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-3-chloro-2-phenylmethoxybenzene (CAS 2244107-77-3) is a chemical compound with the molecular formula C13H10BrClO and a molecular weight of 297.57 g/mol. IUPAC name: 1-bromo-3-chloro-2-phenylmethoxybenzene. InChIKey: PFXOLEIWRMHMQS-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClO |
|---|---|
| Molecular weight | 297.57 g/mol |
| IUPAC name | 1-bromo-3-chloro-2-phenylmethoxybenzene |
| InChIKey | PFXOLEIWRMHMQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Br)Cl |
Computed by PubChem (NCBI)