cas: 41908-23-0 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromonaphthalene, 95+%, 95+% (CAS 41908-23-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLXD-10g |
| cas | 41908-23-0 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3410.00 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 2152.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-phenylmethoxynaphthalene (CAS 41908-23-0) is a chemical compound with the molecular formula C17H13BrO and a molecular weight of 313.2 g/mol. IUPAC name: 1-bromo-2-phenylmethoxynaphthalene. InChIKey: VFQRFYFSXMDHMW-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 1-bromo-2-phenylmethoxynaphthalene |
| InChIKey | VFQRFYFSXMDHMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C3=CC=CC=C3C=C2)Br |
Computed by PubChem (NCBI)