cas: 2586126-33-0 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-3-chloro-5-fluorobenzaldehyde, 98% (CAS 2586126-33-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1638063-10g |
| cas | 2586126-33-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22496.95 Pln | |
| AmBeed | 1g | 3793.72 Pln | |
| AmBeed | 5g | 13272.28 Pln | |
| AmBeed | 25g | 44162.23 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-5-fluoro-2-phenylmethoxybenzaldehyde (CAS 2586126-33-0) is a chemical compound with the molecular formula C14H10ClFO2 and a molecular weight of 264.68 g/mol. IUPAC name: 3-chloro-5-fluoro-2-phenylmethoxybenzaldehyde. InChIKey: ZFEBQPNONPBCCS-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO2 |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 3-chloro-5-fluoro-2-phenylmethoxybenzaldehyde |
| InChIKey | ZFEBQPNONPBCCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)F)C=O |
Computed by PubChem (NCBI)