cas: 2234-45-9 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-6-bromonaphthalene 98% (CAS 2234-45-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A997130-250mg |
| cas | 2234-45-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 348.12 Pln | |
| Ambeed | 25g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A997130 |
2-bromo-6-phenylmethoxynaphthalene (CAS 2234-45-9) is a chemical compound with the molecular formula C17H13BrO and a molecular weight of 313.2 g/mol. IUPAC name: 2-bromo-6-phenylmethoxynaphthalene. InChIKey: QVVBDTXZESAKDU-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 2-bromo-6-phenylmethoxynaphthalene |
| InChIKey | QVVBDTXZESAKDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)