cas: 1253955-71-3 — see every product listed under this CAS number, including other names
2-(Boc-amino)-2-phenylethylamine Hydrochloride, ≥95%, ≥95% (CAS 1253955-71-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NM1-5g |
| cas | 1253955-71-3 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2205.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-amino-1-phenylethyl)carbamate;hydrochloride (CAS 1253955-71-3) is a chemical compound with the molecular formula C13H21ClN2O2 and a molecular weight of 272.77 g/mol. IUPAC name: tert-butyl N-(2-amino-1-phenylethyl)carbamate;hydrochloride. InChIKey: LNGDOFMYIHYSAU-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O2 |
|---|---|
| Molecular weight | 272.77 g/mol |
| IUPAC name | tert-butyl N-(2-amino-1-phenylethyl)carbamate;hydrochloride |
| InChIKey | LNGDOFMYIHYSAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)