cas: 1254381-09-3 — see every product listed under this CAS number, including other names
2-(Boc-methylamino)pyridine-4-boronic acid pinacol ester, 95%, 95% (CAS 1254381-09-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HI8R-250mg |
| cas | 1254381-09-3 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (CAS 1254381-09-3) is a chemical compound with the molecular formula C17H27BN2O4 and a molecular weight of 334.2 g/mol. IUPAC name: tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate. InChIKey: PJGLMYXULHFDKP-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| InChIKey | PJGLMYXULHFDKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)