cas: 91862-40-7 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-1H-benzo[d]imidazole hydrochloride, 95%, 95% (CAS 91862-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120M8K-250mg |
| cas | 91862-40-7 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(chloromethyl)-1H-benzimidazole;hydrochloride (CAS 91862-40-7) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 2-(chloromethyl)-1H-benzimidazole;hydrochloride. InChIKey: IIXABTCJZHHRFL-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 2-(chloromethyl)-1H-benzimidazole;hydrochloride |
| InChIKey | IIXABTCJZHHRFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CCl.Cl |
Computed by PubChem (NCBI)