cas: 150613-50-6 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-1H-benzo[d]imidazole-6-carbonitrile 95% (CAS 150613-50-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217643-100mg |
| cas | 150613-50-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 531.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217643 |
2-(chloromethyl)-3H-benzimidazole-5-carbonitrile (CAS 150613-50-6) is a chemical compound with the molecular formula C9H6ClN3 and a molecular weight of 191.62 g/mol. IUPAC name: 2-(chloromethyl)-3H-benzimidazole-5-carbonitrile. InChIKey: XAMQWUSDVFFTGA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3 |
|---|---|
| Molecular weight | 191.62 g/mol |
| IUPAC name | 2-(chloromethyl)-3H-benzimidazole-5-carbonitrile |
| InChIKey | XAMQWUSDVFFTGA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=N2)CCl |
Computed by PubChem (NCBI)