Products 1060812-69-2
CAS 1060812-69-2 is the registry number for 2-(Chloromethyl)-5-(trifluoromethyl)pyrazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-(chloromethyl)-5-(trifluoromethyl)pyrazine (CAS 1060812-69-2) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 2-(chloromethyl)-5-(trifluoromethyl)pyrazine. InChIKey: FDDCRYZDGUBGAZ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(trifluoromethyl)pyrazine |
| InChIKey | FDDCRYZDGUBGAZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)