cas: 1627839-42-2 — see every product listed under this CAS number, including other names
2-(Cyclopropylmethoxy)-4-fluorophenylboronic acid 96% (CAS 1627839-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A366668-100mg |
| cas | 1627839-42-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 909.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A366668 |
[2-(cyclopropylmethoxy)-4-fluorophenyl]boronic acid (CAS 1627839-42-2) is a chemical compound with the molecular formula C10H12BFO3 and a molecular weight of 210.01 g/mol. IUPAC name: [2-(cyclopropylmethoxy)-4-fluorophenyl]boronic acid. InChIKey: VXIFCATYYMRAES-UHFFFAOYSA-N.
| Molecular formula | C10H12BFO3 |
|---|---|
| Molecular weight | 210.01 g/mol |
| IUPAC name | [2-(cyclopropylmethoxy)-4-fluorophenyl]boronic acid |
| InChIKey | VXIFCATYYMRAES-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)OCC2CC2)(O)O |
Computed by PubChem (NCBI)