cas: 1342025-16-4 — see every product listed under this CAS number, including other names
2-(Cyclopropylmethoxy)-5-fluorobenzonitrile 95% (CAS 1342025-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A259707-100mg |
| cas | 1342025-16-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 487.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A259707 |
2-(cyclopropylmethoxy)-5-fluorobenzonitrile (CAS 1342025-16-4) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 2-(cyclopropylmethoxy)-5-fluorobenzonitrile. InChIKey: MWRGKVOKHWPFFT-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 2-(cyclopropylmethoxy)-5-fluorobenzonitrile |
| InChIKey | MWRGKVOKHWPFFT-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=C(C=C2)F)C#N |
Computed by PubChem (NCBI)