cas: 672937-60-9 — see every product listed under this CAS number, including other names
2-(Dicyclohexylphosphino)-1-phenyl-1H-pyrrole, 98% (CAS 672937-60-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g, 100mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A536148-10g |
| cas | 672937-60-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12543.16 Pln | |
| AmBeed | 250mg | 857.71 Pln | |
| AmBeed | 5g | 6501.88 Pln | |
| AmBeed | 100mg | 616.84 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 500mg | 653.95 Pln | |
| Fluorochem | 1g | 1075.68 Pln | |
| Fluorochem | 2.5g | 2267.97 Pln | |
| Fluorochem | 5g | 4178.75 Pln | |
| Ambeed | 1g | 1043.44 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Dicyclohexyl-(1-phenylpyrrol-2-yl)phosphane (CAS 672937-60-9) is a chemical compound with the molecular formula C22H30NP and a molecular weight of 339.5 g/mol. IUPAC name: dicyclohexyl-(1-phenylpyrrol-2-yl)phosphane. InChIKey: RVFZOTGUPNHVRA-UHFFFAOYSA-N.
| Molecular formula | C22H30NP |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | dicyclohexyl-(1-phenylpyrrol-2-yl)phosphane |
| InChIKey | RVFZOTGUPNHVRA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)P(C2CCCCC2)C3=CC=CN3C4=CC=CC=C4 |
Computed by PubChem (NCBI)