cas: 756520-46-4 — see every product listed under this CAS number, including other names
2-(Diethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide, 95%, 95% (CAS 756520-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EB4Z-100mg |
| cas | 756520-46-4 |
| size | 100mg |
| availability | 3.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1235.60 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(diethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (CAS 756520-46-4) is a chemical compound with the molecular formula C18H31BN2O4S and a molecular weight of 382.3 g/mol. IUPAC name: 2-(diethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide. InChIKey: HBHRVBSRQUCWAJ-UHFFFAOYSA-N.
| Molecular formula | C18H31BN2O4S |
|---|---|
| Molecular weight | 382.3 g/mol |
| IUPAC name | 2-(diethylamino)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| InChIKey | HBHRVBSRQUCWAJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NS(=O)(=O)CCN(CC)CC |
Computed by PubChem (NCBI)