CAS 1308669-92-2 is the registry number for 2-(Difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1308669-92-2) is a chemical compound with the molecular formula C14H16BF2NO3 and a molecular weight of 295.09 g/mol. IUPAC name: 2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: AGQQIBHKPILHSM-UHFFFAOYSA-N.
| Molecular formula | C14H16BF2NO3 |
|---|---|
| Molecular weight | 295.09 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | AGQQIBHKPILHSM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)OC(F)F |
Computed by PubChem (NCBI)