cas: 64224-68-6 — see every product listed under this CAS number, including other names
2-(Dimethylamino)ethyl pyrimidine-5-carboxylate, ≥95%, ≥95% (CAS 64224-68-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKFO-1g |
| cas | 64224-68-6 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1898.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(dimethylamino)pyrimidine-5-carboxylate (CAS 64224-68-6) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: ethyl 2-(dimethylamino)pyrimidine-5-carboxylate. InChIKey: LASQIQPHXMMNLA-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | ethyl 2-(dimethylamino)pyrimidine-5-carboxylate |
| InChIKey | LASQIQPHXMMNLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1)N(C)C |
Computed by PubChem (NCBI)