cas: 369402-98-2 — see every product listed under this CAS number, including other names
2-(Fmoc-amino)-2-(1,1-dioxo-4-tetrahydrothiopyranyl)acetic Acid, 95%, 95% (CAS 369402-98-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D6HA-100mg |
| cas | 369402-98-2 |
| size | 100mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1317.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(1,1-dioxothian-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 369402-98-2) is a chemical compound with the molecular formula C22H23NO6S and a molecular weight of 429.5 g/mol. IUPAC name: 2-(1,1-dioxothian-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: CFGFSMGWGYVIDH-UHFFFAOYSA-N.
| Molecular formula | C22H23NO6S |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 2-(1,1-dioxothian-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | CFGFSMGWGYVIDH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)