cas: 98197-88-7 — see every product listed under this CAS number, including other names
2-(Hydroxymethyl)-4-nitropyridine, 98%, 98% (CAS 98197-88-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F3I-100mg |
| cas | 98197-88-7 |
| size | 100mg |
| availability | 1.21g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 362.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-nitro-2-pyridinyl)methanol (CAS 98197-88-7) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: (4-nitro-2-pyridinyl)methanol. InChIKey: HFSUHEWRFBAVHH-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | (4-nitro-2-pyridinyl)methanol |
| InChIKey | HFSUHEWRFBAVHH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])CO |
Computed by PubChem (NCBI)