cas: 1280210-80-1 — see every product listed under this CAS number, including other names
2-(Methylsulfonyl)-2,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole benzenesulfonate, 98% (CAS 1280210-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F498396-100MG |
| cas | 1280210-80-1 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 25g | 1632.78 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1577.44 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 497.63 Pln | |
| BLDpharm | 25g | 1697.20 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Benzenesulfonic acid;2-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (CAS 1280210-80-1) is a chemical compound with the molecular formula C12H15N3O5S2 and a molecular weight of 345.4 g/mol. IUPAC name: benzenesulfonic acid;2-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole. InChIKey: PKMDOTHXIGJTKH-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O5S2 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | benzenesulfonic acid;2-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| InChIKey | PKMDOTHXIGJTKH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C=C2CNCC2=N1.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)