cas: 1190423-36-9 — see every product listed under this CAS number, including other names
2-(N,N-BISBOC-AMINO)PYRIMIDINE-5-BORONIC ACID, PINACOL ESTER, 95%, 95% (CAS 1190423-36-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111I4O-250mg |
| cas | 1190423-36-9 |
| size | 250mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1134.80 Pln | |
| Chemat | 10g | 1850.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate (CAS 1190423-36-9) is a chemical compound with the molecular formula C20H32BN3O6 and a molecular weight of 421.3 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate. InChIKey: SJJXYKAZGIJVQP-UHFFFAOYSA-N.
| Molecular formula | C20H32BN3O6 |
|---|---|
| Molecular weight | 421.3 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate |
| InChIKey | SJJXYKAZGIJVQP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)