cas: 685892-09-5 — see every product listed under this CAS number, including other names
2-(Piperazin-1-yl)acetic acid -N(2-phenylethyl)-amide (CAS 685892-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018132-1G |
| cas | 685892-09-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 612.30 Pln |
| delivery time | 2-3 weeks |
|---|
N-(2-phenylethyl)-2-piperazin-1-ylacetamide (CAS 685892-09-5) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: N-(2-phenylethyl)-2-piperazin-1-ylacetamide. InChIKey: PMTDWOUIBYJPFJ-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | N-(2-phenylethyl)-2-piperazin-1-ylacetamide |
| InChIKey | PMTDWOUIBYJPFJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC(=O)NCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)