cas: 1015242-07-5 — see every product listed under this CAS number, including other names
2-(Pyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 95%, 95% (CAS 1015242-07-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115PE-100mg |
| cas | 1015242-07-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1015242-07-5) is a chemical compound with the molecular formula C14H22BN3O2 and a molecular weight of 275.16 g/mol. IUPAC name: 2-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: CGSCNCRVBHIXSO-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O2 |
|---|---|
| Molecular weight | 275.16 g/mol |
| IUPAC name | 2-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | CGSCNCRVBHIXSO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCCC3 |
Computed by PubChem (NCBI)