cas: 959748-73-3 — see every product listed under this CAS number, including other names
2-(Tetrahydro-2H-pyran-4-yl)ethyl 4-methylbenzenesulfonate, 98% (CAS 959748-73-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A496779-10g |
| cas | 959748-73-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6417.25 Pln | |
| AmBeed | 25g | 11495.05 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(oxan-4-yl)ethyl 4-methylbenzenesulfonate (CAS 959748-73-3) is a chemical compound with the molecular formula C14H20O4S and a molecular weight of 284.37 g/mol. IUPAC name: 2-(oxan-4-yl)ethyl 4-methylbenzenesulfonate. InChIKey: ODYJPBVJBNREQW-UHFFFAOYSA-N.
| Molecular formula | C14H20O4S |
|---|---|
| Molecular weight | 284.37 g/mol |
| IUPAC name | 2-(oxan-4-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | ODYJPBVJBNREQW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2CCOCC2 |
Computed by PubChem (NCBI)