CAS 536718-30-6 appears in our catalog under these names: 2–(Trifluoromethyl)furan–3–carboxylic acid, 2-(Trifluoromethyl)furan-3-carboxylic acid, 2-(Trifluoromethyl)furan-3-carboxylic acid, 95%, 95%, 2-(TRIFLUOROMETHYL)-3-FUROIC ACID, 95%, 2-(Trifluoromethyl)furan-3-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g, 10g.
2-(trifluoromethyl)furan-3-carboxylic acid (CAS 536718-30-6) is a chemical compound with the molecular formula C6H3F3O3 and a molecular weight of 180.08 g/mol. IUPAC name: 2-(trifluoromethyl)furan-3-carboxylic acid. InChIKey: HYIKIZXFYAKIPK-UHFFFAOYSA-N.
| Molecular formula | C6H3F3O3 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 2-(trifluoromethyl)furan-3-carboxylic acid |
| InChIKey | HYIKIZXFYAKIPK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)