cas: 433332-27-5 — see every product listed under this CAS number, including other names
2-(Triisopropylsilyl)oxazole, 95% (CAS 433332-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616376-100MG |
| cas | 433332-27-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1539.06 Pln | |
| Fluorochem | 250mg | 2575.15 Pln | |
| Fluorochem | 1g | 6823.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1,3-oxazol-2-yl-tri(propan-2-yl)silane (CAS 433332-27-5) is a chemical compound with the molecular formula C12H23NOSi and a molecular weight of 225.40 g/mol. IUPAC name: 1,3-oxazol-2-yl-tri(propan-2-yl)silane. InChIKey: PBDIANQBYUQMPW-UHFFFAOYSA-N.
| Molecular formula | C12H23NOSi |
|---|---|
| Molecular weight | 225.40 g/mol |
| IUPAC name | 1,3-oxazol-2-yl-tri(propan-2-yl)silane |
| InChIKey | PBDIANQBYUQMPW-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C1=NC=CO1)(C(C)C)C(C)C |
Computed by PubChem (NCBI)