Products 20160-60-5

CAS 20160-60-5 is the registry number for 2-(Trimethylsilyl)ethyl carbonochloridate, 90%, 90%. Offered by: Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-trimethylsilylethyl carbonochloridate (CAS 20160-60-5) is a chemical compound with the molecular formula C6H13ClO2Si and a molecular weight of 180.70 g/mol. IUPAC name: 2-trimethylsilylethyl carbonochloridate. InChIKey: BTEQQLFQAPLTLI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClO2Si
Molecular weight180.70 g/mol
IUPAC name2-trimethylsilylethyl carbonochloridate
InChIKeyBTEQQLFQAPLTLI-UHFFFAOYSA-N
SMILESC[Si](C)(C)CCOC(=O)Cl

Computed by PubChem (NCBI)