CAS 4373-61-9 appears in our catalog under these names: 2-(m-Tolyl)pyridine, 95-<97%, 2–(m–Tolyl)pyridine, 2-(M-tolyl)pyridine, 95%, 95%, 2-(3-Methylphenyl)pyridine, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 1g, 250mg.
2-(3-methylphenyl)pyridine (CAS 4373-61-9) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 2-(3-methylphenyl)pyridine. InChIKey: JMTCQDNRTSGBGC-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 2-(3-methylphenyl)pyridine |
| InChIKey | JMTCQDNRTSGBGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)