cas: 3042-57-7 — see every product listed under this CAS number, including other names
2-(pentan-3-yl)naphthalene, 95%, 95% (CAS 3042-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11413V-100mg |
| cas | 3042-57-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-pentan-3-ylnaphthalene (CAS 3042-57-7) is a chemical compound with the molecular formula C15H18 and a molecular weight of 198.30 g/mol. IUPAC name: 2-pentan-3-ylnaphthalene. InChIKey: WXKMPZORXBGZGK-UHFFFAOYSA-N.
| Molecular formula | C15H18 |
|---|---|
| Molecular weight | 198.30 g/mol |
| IUPAC name | 2-pentan-3-ylnaphthalene |
| InChIKey | WXKMPZORXBGZGK-UHFFFAOYSA-N |
| SMILES | CCC(CC)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)