cas: 13395-85-2 — see every product listed under this CAS number, including other names
2-(tert-Butyl)-4-chlorophenol, 97%(GC-MS),RG, 97%(GC-MS),RG (CAS 13395-85-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110HL8-100mg |
| cas | 13395-85-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 2152.40 Pln | |
| Chemat | 25g | 10101.20 Pln |
| purity | 97%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-tert-butyl-4-chlorophenol (CAS 13395-85-2) is a chemical compound with the molecular formula C10H13ClO and a molecular weight of 184.66 g/mol. IUPAC name: 2-tert-butyl-4-chlorophenol. InChIKey: YLSXYZWJAZVUBD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 2-tert-butyl-4-chlorophenol |
| InChIKey | YLSXYZWJAZVUBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)